Tìm kiếm Đề thi, Kiểm tra

Quảng cáo

Quảng cáo

Hướng dẫn sử dụng thư viện

Hỗ trợ kĩ thuật

Liên hệ quảng cáo

  • (04) 66 745 632
  • 0166 286 0000
  • contact@bachkim.vn

BÀI TẬP ESTE - LIPIT HAY

Nhấn vào đây để tải về
Hiển thị toàn màn hình
Báo tài liệu có sai sót
Nhắn tin cho tác giả
(Tài liệu chưa được thẩm định)
Nguồn:
Người gửi: Đỗ Yến
Ngày gửi: 17h:07' 22-09-2017
Dung lượng: 44.6 KB
Số lượt tải: 175
Số lượt thích: 0 người
BÀI TẬP ESTE - LIPIT
DẠNG 1: PHƯƠNG TRÌNH PHẢN ỨNG
1/ HCOO-CH2Cl + NaOH 2/ C6H5COOC6H5 + NaOH 3/ C6H5COOCH2C6H5 + NaOH
4/ CH3COO-CH2-CH2-OOCCH3 + NaOH 5/ HCOOCH2-CH2OOCCH3 + NaOH
6/ CH3OOC - CH2-C2H5 + NaOH 7/ CH3OOC - CH2-COOCH3
8/ CH3COOCH2-CH=CH2 + NaOH 9/ CH3COO-CH=CH-CH3+ NaOH
10/ CH3-CH(OH)-COO-CH(CH3)-COOC2H5 + H2O 11/ CH3COOH + CH( CH
12/ C6H5OH + (CH3CO)2O 13/C2H5COOCH=CH2 + HOH
14/ HCOOCH2COỌCH=CH2 + NaOH 15/HCOOR + NaOH 16/ HCOONa + AgNO3/NH3
DẠNG 2: XÁC ĐỊNH CÔNG THỨC CỦA ESTE ĐƠN CHỨC DỰA VÀO P/Ư ĐỐT CHÁY VÀ P/Ư XÀ PHÒNG HÓA
Bài 1: X là 1 este no, đơn chức, có tỉ khối đối với CH4 là 5,5. Nếu đem đun 2,2g este X với NaOH dư, thu được 2,05g muối. Công thức cấu tạo thu gọn của X là A:HCOOCH2CH2CH3 B:HCOOCH(CH3)2
C: C2H5COCH3 D: CH3COOC2H5
Bài 2: Để thủy phân hoàn toàn 3,3g este đơn chức mạch hở E, ng ta dùng 17,0455ml dung dịch NaOH 10%, Có D= 1,1g/ml( lấy dư 25% so với lượng cần thiết). Biết rằng ít nhất 1 sản phẩm thủy phân có khả năng tham gia phản ứng tráng bạc. Vậy CT thu gọn của E là A: CH3COOCH2CH3 B:HCOO-CH2-CH=CH2 C:HCOOCH2CH2CH3 D: HCOOC(CH3)=CH2
Bài 3: Xà phòng hóa hoàn toàn 26,4g este đơn chức E bằng 450ml dung dịch NaOH 1M. Phản ứng xong cô cạn dung dịch sau p/ư thu được 34,8 g chất rắn khan. Biết tỉ khối hơi của E so với oxi là 2,75. CTCT thu gọn của E là
A: CH3CH2COOCH3 B:CH3COOCH2CH3 C: HCOOCH2COOCH3 D: HCOOCH(CH3)2
Bài 4: Thủy phân hoàn toàn 0,15 mol este E cần vừa đủ 450ml dung dịch NaOH 1M. Cô cạn dung dịch sau p/ư thu được 36,9g muối khan. CTCT thu gọn của E là A: (CH3COO)2C2H4 B: (CH3COO)3C3H5 C: (HCOO)3C3H5 D:C3H5(COOCH3)3
Bài 5: Tỉ khối hơi của este đơn chức E ( chứa C, H, O và ko chứa nhóm chức khác) đối với metan bằng 6,25. Cho 0,225 mol E tác dụng vừa đủ với dung dịch NaOH. Đem cô cạn dung dịch sau p/ư thì thu đc 31,5 g muối khan. Biết E có mạch không phân nhánh. CTCT thu gọn của E là A: CH3CH2COOCH=CH2 B: CH2-CH2-CH2-C=O
C: CH2=CH-COOCH2CH3 D: CH2-CH2-CH2-CH2-C=O


Bài 6: Thủy phân hoàn toàn este E đơn chức RCOOR1 bằng dung dịch NaOH thu được 2 muối có tỉ lệ khối lượng 0,7069. Biết tỉ khối hơi của E đối với oxi nhỏ hơn 4,5 và gốc R1 có 6 nguyên tử C thì CTCT thu gọn của E là
A: CH3COOC6H5 B: HCOOC6H5 C: C3H7COOC6H5 D: C2H5COOC6H5
Bài 7: Xà phòng hóa 8,8 g este E bằng dung dịch NaOH thu được muối X và ancol Y. Nung X với oxi thu được 5,3g Na2CO3, khí CO2 và hơi nước. Cho ancol Y khan tác dụng hết với Na thu được 6,8g muối Z. tên của E là
A: Metyl axetat B: Etylaxetat C: Etyl fomat D: Đimetyl oxa lat
Bài 8: Este no, đơn chức mạch hở E cháy hoàn toàn cho thể tích CO2 sinh ra đúng bằng thể tích của oxi cần cho p/ư cháy(đo cùng nhiệt độ và áp suất). tên đúng của este là A: Propyl fomat B: Metyl fomat C: Metyll axetat
D: Etyl axetat
Bài 9: Đốt cháy hoàn toàn 4,2g chất hữu cơ đơn chức X thu được 6,16g CO2 và 2,52g nước. Biết X tác dụng được với dung dịch NaOH nhưng ko tác dụng với Na. CTCT thu gọn của X là A: CH3COOH B: HCOOC2H5
C: HCOOCH3 D: CH3COOCH3
Bài10: Este E cháy hoàn toàn cần vừa đủ 11,76 lit Oxi, thu được 9,408 lit CO2 và 7,56g nước( các thể tích đều đo ở đktc). CTCT thu gọn nào
Avatar

CHƯƠNG TRÌNH ÔN THI THPT QUỐC GIA MÔN HÓA HỮU CƠ 12: tại đây

Hoặc: http://phuhoat.violet.vn/present/show/entry_id/12126486

 
Gửi ý kiến